C21H24O — CID 141105037
4,6,7-trimethyl-3-[4-(2-methylpropyl)phenyl]-1-benzofuran (PubChem CID 141105037) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is 4,6,7-trimethyl-3-[4-(2-methylpropyl)phenyl]-1-benzofuran.
| Compound Name | 4,6,7-trimethyl-3-[4-(2-methylpropyl)phenyl]-1-benzofuran |
|---|---|
| PubChem CID | 141105037 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 4,6,7-trimethyl-3-[4-(2-methylpropyl)phenyl]-1-benzofuran |
| SMILES | Cc1cc(C)c2c(-c3ccc(CC(C)C)cc3)coc2c1C |
| InChI | InChI=1S/C21H24O/c1-13(2)10-17-6-8-18(9-7-17)19-12-22-21-16(5)14(3)11-15(4)20(19)21/h6-9,11-13H,10H2,1-5H3 |
| InChIKey | FKERWWYFAZHMEP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |