C21H22O3 — CID 141105077
4-[7-methoxy-8-(3-methylbuta-1,3-dienyl)-3,4-dihydro-2H-chromen-2-yl]phenol (PubChem CID 141105077) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is 4-[7-methoxy-8-(3-methylbuta-1,3-dienyl)-3,4-dihydro-2H-chromen-2-yl]phenol.
| Compound Name | 4-[7-methoxy-8-(3-methylbuta-1,3-dienyl)-3,4-dihydro-2H-chromen-2-yl]phenol |
|---|---|
| PubChem CID | 141105077 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 4-[7-methoxy-8-(3-methylbuta-1,3-dienyl)-3,4-dihydro-2H-chromen-2-yl]phenol |
| SMILES | C=C(C)C=Cc1c(OC)ccc2c1OC(c1ccc(O)cc1)CC2 |
| InChI | InChI=1S/C21H22O3/c1-14(2)4-11-18-20(23-3)13-8-16-7-12-19(24-21(16)18)15-5-9-17(22)10-6-15/h4-6,8-11,13,19,22H,1,7,12H2,2-3H3 |
| InChIKey | PNIQJELLWWMGCA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|