About 1,4-diazabicyclo[2.2.2]octane;oxolane
1,4-diazabicyclo[2.2.2]octane;oxolane (PubChem CID 141105414) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is 1,4-diazabicyclo[2.2.2]octane;oxolane.
Molecular Properties
| Compound Name | 1,4-diazabicyclo[2.2.2]octane;oxolane |
| PubChem CID | 141105414 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 1,4-diazabicyclo[2.2.2]octane;oxolane |
| SMILES | C1CCOC1.C1CN2CCN1CC2 |
| InChI | InChI=1S/C6H12N2.C4H8O/c1-2-8-5-3-7(1)4-6-8;1-2-4-5-3-1/h1-6H2;1-4H2 |
| InChIKey | ZUTDEIGDJAYSGN-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,4-diazabicyclo[2.2.2]octane;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diazabicyclo[2.2.2]octane;oxolane?
The IUPAC name of 1,4-diazabicyclo[2.2.2]octane;oxolane (CID 141105414) is 1,4-diazabicyclo[2.2.2]octane;oxolane.
What is the SMILES notation for 1,4-diazabicyclo[2.2.2]octane;oxolane?
The canonical SMILES for 1,4-diazabicyclo[2.2.2]octane;oxolane is C1CCOC1.C1CN2CCN1CC2.
What is the InChIKey of 1,4-diazabicyclo[2.2.2]octane;oxolane?
The InChIKey is ZUTDEIGDJAYSGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.C4H8O/c1-2-8-5-3-7(1)4-6-8;1-2-4-5-3-1/h1-6H2;1-4H2.
What are the key properties of 1,4-diazabicyclo[2.2.2]octane;oxolane?
1,4-diazabicyclo[2.2.2]octane;oxolane has a molecular weight of 184.28 g/mol, XLogP of 0.41, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diazabicyclo[2.2.2]octane;oxolane is sourced from PubChem (CID 141105414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).