C15H22O — CID 14110649
(1aR,7R,7aR,7bS)-1,1,7,7a-tetramethyl-1a,2,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-3-one (PubChem CID 14110649) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (1aR,7R,7aR,7bS)-1,1,7,7a-tetramethyl-1a,2,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-3-one.
| Compound Name | (1aR,7R,7aR,7bS)-1,1,7,7a-tetramethyl-1a,2,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-3-one |
|---|---|
| PubChem CID | 14110649 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (1aR,7R,7aR,7bS)-1,1,7,7a-tetramethyl-1a,2,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-3-one |
| SMILES | C[C@@H]1CCC=C2C(=O)C[C@@H]3[C@@H](C3(C)C)[C@]21C |
| InChI | InChI=1S/C15H22O/c1-9-6-5-7-10-12(16)8-11-13(14(11,2)3)15(9,10)4/h7,9,11,13H,5-6,8H2,1-4H3/t9-,11-,13+,15+/m1/s1 |
| InChIKey | AMWACJANOINTHG-RNKJKDHYSA-N |
| XLogP | 3.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |