C11H20O3 — CID 141106568
2-[3-(methoxymethoxy)propyl]-5,5-dimethyl-2H-furan (PubChem CID 141106568) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-[3-(methoxymethoxy)propyl]-5,5-dimethyl-2H-furan.
| Compound Name | 2-[3-(methoxymethoxy)propyl]-5,5-dimethyl-2H-furan |
|---|---|
| PubChem CID | 141106568 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 2-[3-(methoxymethoxy)propyl]-5,5-dimethyl-2H-furan |
| SMILES | COCOCCCC1C=CC(C)(C)O1 |
| InChI | InChI=1S/C11H20O3/c1-11(2)7-6-10(14-11)5-4-8-13-9-12-3/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | YNABZKBXNUIJAH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|