(2,3-dihydroxy-2,3-dimethylbutyl)boronic acid

C6H15BO4 — CID 141106835

IUPAC(2,3-dihydroxy-2,3-dimethylbutyl)boronic acid
SMILESCC(C)(O)C(C)(O)CB(O)O
InChIInChI=1S/C6H15BO4/c1-5(2,8)6(3,9)4-7(10)11/h8-11H,4H2,1-3H3
InChIKeyQUYYFLQOOJBZMO-UHFFFAOYSA-N
MW161.99 g/mol
LogP-1.02
Rot. Bonds3

About (2,3-dihydroxy-2,3-dimethylbutyl)boronic acid

(2,3-dihydroxy-2,3-dimethylbutyl)boronic acid (PubChem CID 141106835) has the molecular formula C6H15BO4 and a molecular weight of 161.99 g/mol. Its IUPAC name is (2,3-dihydroxy-2,3-dimethylbutyl)boronic acid.

Molecular Properties

Compound Name(2,3-dihydroxy-2,3-dimethylbutyl)boronic acid
PubChem CID141106835
Molecular FormulaC6H15BO4
Molecular Weight161.99 g/mol
Exact Mass162.11
IUPAC Name(2,3-dihydroxy-2,3-dimethylbutyl)boronic acid
SMILESCC(C)(O)C(C)(O)CB(O)O
InChIInChI=1S/C6H15BO4/c1-5(2,8)6(3,9)4-7(10)11/h8-11H,4H2,1-3H3
InChIKeyQUYYFLQOOJBZMO-UHFFFAOYSA-N
XLogP-1.02
TPSA80.92 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.99
LogP ≤ 5-1.02
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (2,3-dihydroxy-2,3-dimethylbutyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,3-dihydroxy-2,3-dimethylbutyl)boronic acid?
The IUPAC name of (2,3-dihydroxy-2,3-dimethylbutyl)boronic acid (CID 141106835) is (2,3-dihydroxy-2,3-dimethylbutyl)boronic acid.
What is the SMILES notation for (2,3-dihydroxy-2,3-dimethylbutyl)boronic acid?
The canonical SMILES for (2,3-dihydroxy-2,3-dimethylbutyl)boronic acid is CC(C)(O)C(C)(O)CB(O)O.
What is the InChIKey of (2,3-dihydroxy-2,3-dimethylbutyl)boronic acid?
The InChIKey is QUYYFLQOOJBZMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15BO4/c1-5(2,8)6(3,9)4-7(10)11/h8-11H,4H2,1-3H3.
What are the key properties of (2,3-dihydroxy-2,3-dimethylbutyl)boronic acid?
(2,3-dihydroxy-2,3-dimethylbutyl)boronic acid has a molecular weight of 161.99 g/mol, XLogP of -1.02, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dihydroxy-2,3-dimethylbutyl)boronic acid is sourced from PubChem (CID 141106835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).