C15H27N — CID 141107076
1-(2,2,6,6-tetramethylcyclohex-3-en-1-yl)piperidine (PubChem CID 141107076) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 1-(2,2,6,6-tetramethylcyclohex-3-en-1-yl)piperidine.
| Compound Name | 1-(2,2,6,6-tetramethylcyclohex-3-en-1-yl)piperidine |
|---|---|
| PubChem CID | 141107076 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 1-(2,2,6,6-tetramethylcyclohex-3-en-1-yl)piperidine |
| SMILES | CC1(C)C=CCC(C)(C)C1N1CCCCC1 |
| InChI | InChI=1S/C15H27N/c1-14(2)9-8-10-15(3,4)13(14)16-11-6-5-7-12-16/h8-9,13H,5-7,10-12H2,1-4H3 |
| InChIKey | KBMLHSVKIREUJW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|