C47H32N6O — CID 141107884
3-[3-(2-benzofuran-1-yl)-5-(2,3-dihydroindol-1-yl)-7-indolizin-1-yl-6-(1H-indol-2-yl)-2H-isoindol-1-yl]-1H-indazole (PubChem CID 141107884) has the molecular formula C47H32N6O and a molecular weight of 696.81 g/mol. Its IUPAC name is 3-[3-(2-benzofuran-1-yl)-5-(2,3-dihydroindol-1-yl)-7-indolizin-1-yl-6-(1H-indol-2-yl)-2H-isoindol-1-yl]-1H-indazole.
| Compound Name | 3-[3-(2-benzofuran-1-yl)-5-(2,3-dihydroindol-1-yl)-7-indolizin-1-yl-6-(1H-indol-2-yl)-2H-isoindol-1-yl]-1H-indazole |
|---|---|
| PubChem CID | 141107884 |
| Molecular Formula | C47H32N6O |
| Molecular Weight | 696.81 g/mol |
| Exact Mass | 696.26 |
| IUPAC Name | 3-[3-(2-benzofuran-1-yl)-5-(2,3-dihydroindol-1-yl)-7-indolizin-1-yl-6-(1H-indol-2-yl)-2H-isoindol-1-yl]-1H-indazole |
| SMILES | c1ccc2c(c1)CCN2c1cc2c(-c3occ4ccccc34)[nH]c(-c3n[nH]c4ccccc34)c2c(-c2ccn3ccccc23)c1-c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C47H32N6O/c1-4-14-31-30(13-1)27-54-47(31)45-34-26-40(53-24-20-28-11-3-8-18-38(28)53)43(37-25-29-12-2-6-16-35(29)48-37)41(33-21-23-52-22-10-9-19-39(33)52)42(34)46(49-45)44-32-15-5-7-17-36(32)50-51-44/h1-19,21-23,25-27,48-49H,20,24H2,(H,50,51) |
| InChIKey | LVOCJAGKFRCCOI-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.81 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|