C26H19Cl2N3O3 — CID 141108175
2-[3-[5,6-dichloro-1-(2-methylbenzoyl)benzimidazol-2-yl]propyl]isoindole-1,3-dione (PubChem CID 141108175) has the molecular formula C26H19Cl2N3O3 and a molecular weight of 492.36 g/mol. Its IUPAC name is 2-[3-[5,6-dichloro-1-(2-methylbenzoyl)benzimidazol-2-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[5,6-dichloro-1-(2-methylbenzoyl)benzimidazol-2-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 141108175 |
| Molecular Formula | C26H19Cl2N3O3 |
| Molecular Weight | 492.36 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 2-[3-[5,6-dichloro-1-(2-methylbenzoyl)benzimidazol-2-yl]propyl]isoindole-1,3-dione |
| SMILES | Cc1ccccc1C(=O)n1c(CCCN2C(=O)c3ccccc3C2=O)nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C26H19Cl2N3O3/c1-15-7-2-3-8-16(15)26(34)31-22-14-20(28)19(27)13-21(22)29-23(31)11-6-12-30-24(32)17-9-4-5-10-18(17)25(30)33/h2-5,7-10,13-14H,6,11-12H2,1H3 |
| InChIKey | RTYQHSOUIYYUMI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.36 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|