C10H13ClN2 — CID 141108596
7-chloro-3,3-dimethyl-2,4-dihydro-1H-1,8-naphthyridine (PubChem CID 141108596) has the molecular formula C10H13ClN2 and a molecular weight of 196.68 g/mol. Its IUPAC name is 7-chloro-3,3-dimethyl-2,4-dihydro-1H-1,8-naphthyridine.
| Compound Name | 7-chloro-3,3-dimethyl-2,4-dihydro-1H-1,8-naphthyridine |
|---|---|
| PubChem CID | 141108596 |
| Molecular Formula | C10H13ClN2 |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 7-chloro-3,3-dimethyl-2,4-dihydro-1H-1,8-naphthyridine |
| SMILES | CC1(C)CNc2nc(Cl)ccc2C1 |
| InChI | InChI=1S/C10H13ClN2/c1-10(2)5-7-3-4-8(11)13-9(7)12-6-10/h3-4H,5-6H2,1-2H3,(H,12,13) |
| InChIKey | MYDGWURLJXYPNY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|