About 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1,2-dihydro-1,8-naphthyridine
7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1,2-dihydro-1,8-naphthyridine (PubChem CID 141108618) has the molecular formula C24H28N4OS
and a molecular weight of 420.58 g/mol. Its IUPAC name is 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1,2-dihydro-1,8-naphthyridine.
Molecular Properties
| Compound Name | 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1,2-dihydro-1,8-naphthyridine |
| PubChem CID | 141108618 |
| Molecular Formula | C24H28N4OS |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1,2-dihydro-1,8-naphthyridine |
| SMILES | C1=Cc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)nc2NC1 |
| InChI | InChI=1S/C24H28N4OS/c1(2-17-29-23-9-8-19-5-4-11-25-24(19)26-23)12-27-13-15-28(16-14-27)21-6-3-7-22-20(21)10-18-30-22/h3-10,18H,1-2,11-17H2,(H,25,26) |
| InChIKey | VADJOBDUACGEHB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1,2-dihydro-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1,2-dihydro-1,8-naphthyridine?
The IUPAC name of 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1,2-dihydro-1,8-naphthyridine (CID 141108618) is 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1,2-dihydro-1,8-naphthyridine.
What is the SMILES notation for 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1,2-dihydro-1,8-naphthyridine?
The canonical SMILES for 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1,2-dihydro-1,8-naphthyridine is C1=Cc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)nc2NC1.
What is the InChIKey of 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1,2-dihydro-1,8-naphthyridine?
The InChIKey is VADJOBDUACGEHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N4OS/c1(2-17-29-23-9-8-19-5-4-11-25-24(19)26-23)12-27-13-15-28(16-14-27)21-6-3-7-22-20(21)10-18-30-22/h3-10,18H,1-2,11-17H2,(H,25,26).
What are the key properties of 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1,2-dihydro-1,8-naphthyridine?
7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1,2-dihydro-1,8-naphthyridine has a molecular weight of 420.58 g/mol, XLogP of 4.72, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1,2-dihydro-1,8-naphthyridine is sourced from PubChem (CID 141108618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).