C16H23NO2 — CID 141108738
4-(3,4,4a,5,6,6a-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl)butan-1-ol (PubChem CID 141108738) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 4-(3,4,4a,5,6,6a-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl)butan-1-ol.
| Compound Name | 4-(3,4,4a,5,6,6a-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl)butan-1-ol |
|---|---|
| PubChem CID | 141108738 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 4-(3,4,4a,5,6,6a-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl)butan-1-ol |
| SMILES | OCCCCC1NC2C=CC=CC2=C2OCCCC21 |
| InChI | InChI=1S/C16H23NO2/c18-10-4-3-9-15-13-7-5-11-19-16(13)12-6-1-2-8-14(12)17-15/h1-2,6,8,13-15,17-18H,3-5,7,9-11H2 |
| InChIKey | NGKOXMYQCRSNRD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|