C17H25NO2 — CID 141108741
4-(9-methyl-3,4,4a,5,6,6a-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl)butan-1-ol (PubChem CID 141108741) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 4-(9-methyl-3,4,4a,5,6,6a-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl)butan-1-ol.
| Compound Name | 4-(9-methyl-3,4,4a,5,6,6a-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl)butan-1-ol |
|---|---|
| PubChem CID | 141108741 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 4-(9-methyl-3,4,4a,5,6,6a-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl)butan-1-ol |
| SMILES | CC1=CC2=C3OCCCC3C(CCCCO)NC2C=C1 |
| InChI | InChI=1S/C17H25NO2/c1-12-7-8-16-14(11-12)17-13(5-4-10-20-17)15(18-16)6-2-3-9-19/h7-8,11,13,15-16,18-19H,2-6,9-10H2,1H3 |
| InChIKey | VRSINWYGDBFGHA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|