About 2-(ethoxymethyl)-7-(1,3-thiazol-4-ylmethoxy)imidazo[4,5-c]quinolin-1-amine
2-(ethoxymethyl)-7-(1,3-thiazol-4-ylmethoxy)imidazo[4,5-c]quinolin-1-amine (PubChem CID 141108814) has the molecular formula C17H17N5O2S
and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-(ethoxymethyl)-7-(1,3-thiazol-4-ylmethoxy)imidazo[4,5-c]quinolin-1-amine.
Molecular Properties
| Compound Name | 2-(ethoxymethyl)-7-(1,3-thiazol-4-ylmethoxy)imidazo[4,5-c]quinolin-1-amine |
| PubChem CID | 141108814 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-(ethoxymethyl)-7-(1,3-thiazol-4-ylmethoxy)imidazo[4,5-c]quinolin-1-amine |
| SMILES | CCOCc1nc2cnc3cc(OCc4cscn4)ccc3c2n1N |
| InChI | InChI=1S/C17H17N5O2S/c1-2-23-8-16-21-15-6-19-14-5-12(24-7-11-9-25-10-20-11)3-4-13(14)17(15)22(16)18/h3-6,9-10H,2,7-8,18H2,1H3 |
| InChIKey | QFKZZQBIRHRENJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-(ethoxymethyl)-7-(1,3-thiazol-4-ylmethoxy)imidazo[4,5-c]quinolin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethoxymethyl)-7-(1,3-thiazol-4-ylmethoxy)imidazo[4,5-c]quinolin-1-amine?
The IUPAC name of 2-(ethoxymethyl)-7-(1,3-thiazol-4-ylmethoxy)imidazo[4,5-c]quinolin-1-amine (CID 141108814) is 2-(ethoxymethyl)-7-(1,3-thiazol-4-ylmethoxy)imidazo[4,5-c]quinolin-1-amine.
What is the SMILES notation for 2-(ethoxymethyl)-7-(1,3-thiazol-4-ylmethoxy)imidazo[4,5-c]quinolin-1-amine?
The canonical SMILES for 2-(ethoxymethyl)-7-(1,3-thiazol-4-ylmethoxy)imidazo[4,5-c]quinolin-1-amine is CCOCc1nc2cnc3cc(OCc4cscn4)ccc3c2n1N.
What is the InChIKey of 2-(ethoxymethyl)-7-(1,3-thiazol-4-ylmethoxy)imidazo[4,5-c]quinolin-1-amine?
The InChIKey is QFKZZQBIRHRENJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N5O2S/c1-2-23-8-16-21-15-6-19-14-5-12(24-7-11-9-25-10-20-11)3-4-13(14)17(15)22(16)18/h3-6,9-10H,2,7-8,18H2,1H3.
What are the key properties of 2-(ethoxymethyl)-7-(1,3-thiazol-4-ylmethoxy)imidazo[4,5-c]quinolin-1-amine?
2-(ethoxymethyl)-7-(1,3-thiazol-4-ylmethoxy)imidazo[4,5-c]quinolin-1-amine has a molecular weight of 355.42 g/mol, XLogP of 2.87, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethoxymethyl)-7-(1,3-thiazol-4-ylmethoxy)imidazo[4,5-c]quinolin-1-amine is sourced from PubChem (CID 141108814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).