C11H9F9O2S — CID 141109040
1-butylsulfonyl-2,3,4,5,5,6,6,7,7-nonafluorobicyclo[2.2.1]hept-2-ene (PubChem CID 141109040) has the molecular formula C11H9F9O2S and a molecular weight of 376.24 g/mol. Its IUPAC name is 1-butylsulfonyl-2,3,4,5,5,6,6,7,7-nonafluorobicyclo[2.2.1]hept-2-ene.
| Compound Name | 1-butylsulfonyl-2,3,4,5,5,6,6,7,7-nonafluorobicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 141109040 |
| Molecular Formula | C11H9F9O2S |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 1-butylsulfonyl-2,3,4,5,5,6,6,7,7-nonafluorobicyclo[2.2.1]hept-2-ene |
| SMILES | CCCCS(=O)(=O)C12C(F)=C(F)C(F)(C(F)(F)C1(F)F)C2(F)F |
| InChI | InChI=1S/C11H9F9O2S/c1-2-3-4-23(21,22)8-6(13)5(12)7(14,9(8,15)16)10(17,18)11(8,19)20/h2-4H2,1H3 |
| InChIKey | HANIJOVEJZYODX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|