About [4-(aminomethylimino)cyclohexa-1,5-dien-1-yl]urea
[4-(aminomethylimino)cyclohexa-1,5-dien-1-yl]urea (PubChem CID 141109200) has the molecular formula C8H12N4O
and a molecular weight of 180.21 g/mol. Its IUPAC name is [4-(aminomethylimino)cyclohexa-1,5-dien-1-yl]urea.
Molecular Properties
| Compound Name | [4-(aminomethylimino)cyclohexa-1,5-dien-1-yl]urea |
| PubChem CID | 141109200 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | [4-(aminomethylimino)cyclohexa-1,5-dien-1-yl]urea |
| SMILES | NCN=C1C=CC(NC(N)=O)=CC1 |
| InChI | InChI=1S/C8H12N4O/c9-5-11-6-1-3-7(4-2-6)12-8(10)13/h1,3-4H,2,5,9H2,(H3,10,12,13) |
| InChIKey | VNPKWMXPQKGZMZ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(aminomethylimino)cyclohexa-1,5-dien-1-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(aminomethylimino)cyclohexa-1,5-dien-1-yl]urea?
The IUPAC name of [4-(aminomethylimino)cyclohexa-1,5-dien-1-yl]urea (CID 141109200) is [4-(aminomethylimino)cyclohexa-1,5-dien-1-yl]urea.
What is the SMILES notation for [4-(aminomethylimino)cyclohexa-1,5-dien-1-yl]urea?
The canonical SMILES for [4-(aminomethylimino)cyclohexa-1,5-dien-1-yl]urea is NCN=C1C=CC(NC(N)=O)=CC1.
What is the InChIKey of [4-(aminomethylimino)cyclohexa-1,5-dien-1-yl]urea?
The InChIKey is VNPKWMXPQKGZMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O/c9-5-11-6-1-3-7(4-2-6)12-8(10)13/h1,3-4H,2,5,9H2,(H3,10,12,13).
What are the key properties of [4-(aminomethylimino)cyclohexa-1,5-dien-1-yl]urea?
[4-(aminomethylimino)cyclohexa-1,5-dien-1-yl]urea has a molecular weight of 180.21 g/mol, XLogP of -0.14, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(aminomethylimino)cyclohexa-1,5-dien-1-yl]urea is sourced from PubChem (CID 141109200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).