About 2,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-one
2,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-one (PubChem CID 141109500) has the molecular formula C7H8O4
and a molecular weight of 156.14 g/mol. Its IUPAC name is 2,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 2,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-one |
| PubChem CID | 141109500 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 2,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-one |
| SMILES | COC1=CC(O)C(=O)C(O)=C1 |
| InChI | InChI=1S/C7H8O4/c1-11-4-2-5(8)7(10)6(9)3-4/h2-3,5,8-9H,1H3 |
| InChIKey | STSNOZIZQRUNGL-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-one?
The IUPAC name of 2,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-one (CID 141109500) is 2,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-one.
What is the SMILES notation for 2,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-one?
The canonical SMILES for 2,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-one is COC1=CC(O)C(=O)C(O)=C1.
What is the InChIKey of 2,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-one?
The InChIKey is STSNOZIZQRUNGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4/c1-11-4-2-5(8)7(10)6(9)3-4/h2-3,5,8-9H,1H3.
What are the key properties of 2,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-one?
2,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-one has a molecular weight of 156.14 g/mol, XLogP of -0.10, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-one is sourced from PubChem (CID 141109500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).