About 3-methyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid
3-methyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid (PubChem CID 141109652) has the molecular formula C8H7NO2S
and a molecular weight of 181.22 g/mol. Its IUPAC name is 3-methyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-methyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid |
| PubChem CID | 141109652 |
| Molecular Formula | C8H7NO2S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 3-methyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid |
| SMILES | Cc1c(C(=O)O)sc2cc[nH]c12 |
| InChI | InChI=1S/C8H7NO2S/c1-4-6-5(2-3-9-6)12-7(4)8(10)11/h2-3,9H,1H3,(H,10,11) |
| InChIKey | WTCOSQHMDZJMAG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid?
The IUPAC name of 3-methyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid (CID 141109652) is 3-methyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid.
What is the SMILES notation for 3-methyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid?
The canonical SMILES for 3-methyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid is Cc1c(C(=O)O)sc2cc[nH]c12.
What is the InChIKey of 3-methyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid?
The InChIKey is WTCOSQHMDZJMAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2S/c1-4-6-5(2-3-9-6)12-7(4)8(10)11/h2-3,9H,1H3,(H,10,11).
What are the key properties of 3-methyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid?
3-methyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid has a molecular weight of 181.22 g/mol, XLogP of 2.24, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid is sourced from PubChem (CID 141109652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).