C13H20N2O5 — CID 141109878
(E)-3-butoxycarbonyl-5-(ethylidenecarbamoylamino)pent-2-enoic acid (PubChem CID 141109878) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is (E)-3-butoxycarbonyl-5-(ethylidenecarbamoylamino)pent-2-enoic acid.
| Compound Name | (E)-3-butoxycarbonyl-5-(ethylidenecarbamoylamino)pent-2-enoic acid |
|---|---|
| PubChem CID | 141109878 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (E)-3-butoxycarbonyl-5-(ethylidenecarbamoylamino)pent-2-enoic acid |
| SMILES | CC=NC(=O)NCC/C(=C\C(=O)O)C(=O)OCCCC |
| InChI | InChI=1S/C13H20N2O5/c1-3-5-8-20-12(18)10(9-11(16)17)6-7-15-13(19)14-4-2/h4,9H,3,5-8H2,1-2H3,(H,15,19)(H,16,17)/b10-9+,14-4? |
| InChIKey | BQCVBLOEUNJCSQ-SYXCPTMZSA-N |
| XLogP | 1.53 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|