C13H19NO3 — CID 141110107
3-(5,5-dimethyl-1,3-dioxan-2-yl)-4-methoxyaniline (PubChem CID 141110107) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-(5,5-dimethyl-1,3-dioxan-2-yl)-4-methoxyaniline.
| Compound Name | 3-(5,5-dimethyl-1,3-dioxan-2-yl)-4-methoxyaniline |
|---|---|
| PubChem CID | 141110107 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 3-(5,5-dimethyl-1,3-dioxan-2-yl)-4-methoxyaniline |
| SMILES | COc1ccc(N)cc1C1OCC(C)(C)CO1 |
| InChI | InChI=1S/C13H19NO3/c1-13(2)7-16-12(17-8-13)10-6-9(14)4-5-11(10)15-3/h4-6,12H,7-8,14H2,1-3H3 |
| InChIKey | FPHXSZQLXVEWJH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|