C17H13N3OS — CID 141110438
(E)-3-[4-amino-3-(3-methoxyphenyl)thieno[3,2-c]pyridin-7-yl]prop-2-enenitrile (PubChem CID 141110438) has the molecular formula C17H13N3OS and a molecular weight of 307.38 g/mol. Its IUPAC name is (E)-3-[4-amino-3-(3-methoxyphenyl)thieno[3,2-c]pyridin-7-yl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-amino-3-(3-methoxyphenyl)thieno[3,2-c]pyridin-7-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 141110438 |
| Molecular Formula | C17H13N3OS |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | (E)-3-[4-amino-3-(3-methoxyphenyl)thieno[3,2-c]pyridin-7-yl]prop-2-enenitrile |
| SMILES | COc1cccc(-c2csc3c(/C=C/C#N)cnc(N)c23)c1 |
| InChI | InChI=1S/C17H13N3OS/c1-21-13-6-2-4-11(8-13)14-10-22-16-12(5-3-7-18)9-20-17(19)15(14)16/h2-6,8-10H,1H3,(H2,19,20)/b5-3+ |
| InChIKey | MNBYNFHNORXVGH-HWKANZROSA-N |
| XLogP | 4.09 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|