About 3-(4,5-dichloro-3-methylthiophen-2-yl)-2-(4-methoxyphenyl)imidazo[1,2-a]pyrimidine
3-(4,5-dichloro-3-methylthiophen-2-yl)-2-(4-methoxyphenyl)imidazo[1,2-a]pyrimidine (PubChem CID 141110720) has the molecular formula C18H13Cl2N3OS
and a molecular weight of 390.30 g/mol. Its IUPAC name is 3-(4,5-dichloro-3-methylthiophen-2-yl)-2-(4-methoxyphenyl)imidazo[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | 3-(4,5-dichloro-3-methylthiophen-2-yl)-2-(4-methoxyphenyl)imidazo[1,2-a]pyrimidine |
| PubChem CID | 141110720 |
| Molecular Formula | C18H13Cl2N3OS |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 3-(4,5-dichloro-3-methylthiophen-2-yl)-2-(4-methoxyphenyl)imidazo[1,2-a]pyrimidine |
| SMILES | COc1ccc(-c2nc3ncccn3c2-c2sc(Cl)c(Cl)c2C)cc1 |
| InChI | InChI=1S/C18H13Cl2N3OS/c1-10-13(19)17(20)25-16(10)15-14(11-4-6-12(24-2)7-5-11)22-18-21-8-3-9-23(15)18/h3-9H,1-2H3 |
| InChIKey | FTBMZFUNPKNQNA-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4,5-dichloro-3-methylthiophen-2-yl)-2-(4-methoxyphenyl)imidazo[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dichloro-3-methylthiophen-2-yl)-2-(4-methoxyphenyl)imidazo[1,2-a]pyrimidine?
The IUPAC name of 3-(4,5-dichloro-3-methylthiophen-2-yl)-2-(4-methoxyphenyl)imidazo[1,2-a]pyrimidine (CID 141110720) is 3-(4,5-dichloro-3-methylthiophen-2-yl)-2-(4-methoxyphenyl)imidazo[1,2-a]pyrimidine.
What is the SMILES notation for 3-(4,5-dichloro-3-methylthiophen-2-yl)-2-(4-methoxyphenyl)imidazo[1,2-a]pyrimidine?
The canonical SMILES for 3-(4,5-dichloro-3-methylthiophen-2-yl)-2-(4-methoxyphenyl)imidazo[1,2-a]pyrimidine is COc1ccc(-c2nc3ncccn3c2-c2sc(Cl)c(Cl)c2C)cc1.
What is the InChIKey of 3-(4,5-dichloro-3-methylthiophen-2-yl)-2-(4-methoxyphenyl)imidazo[1,2-a]pyrimidine?
The InChIKey is FTBMZFUNPKNQNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl2N3OS/c1-10-13(19)17(20)25-16(10)15-14(11-4-6-12(24-2)7-5-11)22-18-21-8-3-9-23(15)18/h3-9H,1-2H3.
What are the key properties of 3-(4,5-dichloro-3-methylthiophen-2-yl)-2-(4-methoxyphenyl)imidazo[1,2-a]pyrimidine?
3-(4,5-dichloro-3-methylthiophen-2-yl)-2-(4-methoxyphenyl)imidazo[1,2-a]pyrimidine has a molecular weight of 390.30 g/mol, XLogP of 5.75, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dichloro-3-methylthiophen-2-yl)-2-(4-methoxyphenyl)imidazo[1,2-a]pyrimidine is sourced from PubChem (CID 141110720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).