C27H28O7 — CID 141111063
10-[methoxy-(2,3,4,5,6-pentamethoxyphenyl)methyl]-10H-anthracen-9-one (PubChem CID 141111063) has the molecular formula C27H28O7 and a molecular weight of 464.51 g/mol. Its IUPAC name is 10-[methoxy-(2,3,4,5,6-pentamethoxyphenyl)methyl]-10H-anthracen-9-one.
| Compound Name | 10-[methoxy-(2,3,4,5,6-pentamethoxyphenyl)methyl]-10H-anthracen-9-one |
|---|---|
| PubChem CID | 141111063 |
| Molecular Formula | C27H28O7 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 10-[methoxy-(2,3,4,5,6-pentamethoxyphenyl)methyl]-10H-anthracen-9-one |
| SMILES | COc1c(OC)c(OC)c(C(OC)C2c3ccccc3C(=O)c3ccccc32)c(OC)c1OC |
| InChI | InChI=1S/C27H28O7/c1-29-22(20-23(30-2)25(32-4)27(34-6)26(33-5)24(20)31-3)19-15-11-7-9-13-17(15)21(28)18-14-10-8-12-16(18)19/h7-14,19,22H,1-6H3 |
| InChIKey | ILHOGJKKBXVXBL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |