About (4E)-6-[(3E)-hepta-3,6-dien-2-yl]oxyhepta-1,4-diene
(4E)-6-[(3E)-hepta-3,6-dien-2-yl]oxyhepta-1,4-diene (PubChem CID 14111129) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is (4E)-6-[(3E)-hepta-3,6-dien-2-yl]oxyhepta-1,4-diene.
Molecular Properties
| Compound Name | (4E)-6-[(3E)-hepta-3,6-dien-2-yl]oxyhepta-1,4-diene |
| PubChem CID | 14111129 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (4E)-6-[(3E)-hepta-3,6-dien-2-yl]oxyhepta-1,4-diene |
| SMILES | C=CC/C=C/C(C)OC(C)/C=C/CC=C |
| InChI | InChI=1S/C14H22O/c1-5-7-9-11-13(3)15-14(4)12-10-8-6-2/h5-6,9-14H,1-2,7-8H2,3-4H3/b11-9+,12-10+ |
| InChIKey | VFSCODGQOVDEHD-WGDLNXRISA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-6-[(3E)-hepta-3,6-dien-2-yl]oxyhepta-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-6-[(3E)-hepta-3,6-dien-2-yl]oxyhepta-1,4-diene?
The IUPAC name of (4E)-6-[(3E)-hepta-3,6-dien-2-yl]oxyhepta-1,4-diene (CID 14111129) is (4E)-6-[(3E)-hepta-3,6-dien-2-yl]oxyhepta-1,4-diene.
What is the SMILES notation for (4E)-6-[(3E)-hepta-3,6-dien-2-yl]oxyhepta-1,4-diene?
The canonical SMILES for (4E)-6-[(3E)-hepta-3,6-dien-2-yl]oxyhepta-1,4-diene is C=CC/C=C/C(C)OC(C)/C=C/CC=C.
What is the InChIKey of (4E)-6-[(3E)-hepta-3,6-dien-2-yl]oxyhepta-1,4-diene?
The InChIKey is VFSCODGQOVDEHD-WGDLNXRISA-N. The full InChI is InChI=1S/C14H22O/c1-5-7-9-11-13(3)15-14(4)12-10-8-6-2/h5-6,9-14H,1-2,7-8H2,3-4H3/b11-9+,12-10+.
What are the key properties of (4E)-6-[(3E)-hepta-3,6-dien-2-yl]oxyhepta-1,4-diene?
(4E)-6-[(3E)-hepta-3,6-dien-2-yl]oxyhepta-1,4-diene has a molecular weight of 206.33 g/mol, XLogP of 4.04, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-6-[(3E)-hepta-3,6-dien-2-yl]oxyhepta-1,4-diene is sourced from PubChem (CID 14111129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).