C13H14N2O2S2 — CID 141111852
2-[2,6-bis(sulfanyl)piperidin-3-yl]isoindole-1,3-dione (PubChem CID 141111852) has the molecular formula C13H14N2O2S2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-[2,6-bis(sulfanyl)piperidin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[2,6-bis(sulfanyl)piperidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 141111852 |
| Molecular Formula | C13H14N2O2S2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-[2,6-bis(sulfanyl)piperidin-3-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C1CCC(S)NC1S |
| InChI | InChI=1S/C13H14N2O2S2/c16-12-7-3-1-2-4-8(7)13(17)15(12)9-5-6-10(18)14-11(9)19/h1-4,9-11,14,18-19H,5-6H2 |
| InChIKey | HYOLMAGYUMXZQT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|