C13H12FNO4 — CID 141112554
1-[(4-fluorophenyl)methyl]-4-hydroxy-6-oxo-2,3-dihydropyridine-5-carboxylic acid (PubChem CID 141112554) has the molecular formula C13H12FNO4 and a molecular weight of 265.24 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-4-hydroxy-6-oxo-2,3-dihydropyridine-5-carboxylic acid.
| Compound Name | 1-[(4-fluorophenyl)methyl]-4-hydroxy-6-oxo-2,3-dihydropyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 141112554 |
| Molecular Formula | C13H12FNO4 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-4-hydroxy-6-oxo-2,3-dihydropyridine-5-carboxylic acid |
| SMILES | O=C(O)C1=C(O)CCN(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C13H12FNO4/c14-9-3-1-8(2-4-9)7-15-6-5-10(16)11(12(15)17)13(18)19/h1-4,16H,5-7H2,(H,18,19) |
| InChIKey | IIWNNCQTEUWZCU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|