C26H45NO11S — CID 141112651
[(2R)-2-[(2S,3S,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-(dihexylsulfamoyl)oxolan-2-yl]-2-(2-deuterioacetyl)oxyethyl] 2-deuterioacetate (PubChem CID 141112651) has the molecular formula C26H45NO11S and a molecular weight of 583.73 g/mol. Its IUPAC name is [(2R)-2-[(2S,3S,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-(dihexylsulfamoyl)oxolan-2-yl]-2-(2-deuterioacetyl)oxyethyl] 2-deuterioacetate.
| Compound Name | [(2R)-2-[(2S,3S,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-(dihexylsulfamoyl)oxolan-2-yl]-2-(2-deuterioacetyl)oxyethyl] 2-deuterioacetate |
|---|---|
| PubChem CID | 141112651 |
| Molecular Formula | C26H45NO11S |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.30 |
| IUPAC Name | [(2R)-2-[(2S,3S,4R)-3,4-bis[(2-deuterioacetyl)oxy]-5-(dihexylsulfamoyl)oxolan-2-yl]-2-(2-deuterioacetyl)oxyethyl] 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@@H](OC(=O)C[2H])[C@@H]1OC(S(=O)(=O)N(CCCCCC)CCCCCC)[C@H](OC(=O)C[2H])[C@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C26H45NO11S/c1-7-9-11-13-15-27(16-14-12-10-8-2)39(32,33)26-25(37-21(6)31)24(36-20(5)30)23(38-26)22(35-19(4)29)17-34-18(3)28/h22-26H,7-17H2,1-6H3/t22-,23+,24+,25-,26?/m1/s1/i3D,4D,5D,6D |
| InChIKey | FYWBKLHMVPHJJF-ZXJXHDHVSA-N |
| XLogP | 2.86 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|