C22H24Cl2N2O — CID 141113079
1-[2-(azetidin-1-yl)ethyl]-5-[3-(2,4-dichlorophenyl)propoxy]indole (PubChem CID 141113079) has the molecular formula C22H24Cl2N2O and a molecular weight of 403.35 g/mol. Its IUPAC name is 1-[2-(azetidin-1-yl)ethyl]-5-[3-(2,4-dichlorophenyl)propoxy]indole.
| Compound Name | 1-[2-(azetidin-1-yl)ethyl]-5-[3-(2,4-dichlorophenyl)propoxy]indole |
|---|---|
| PubChem CID | 141113079 |
| Molecular Formula | C22H24Cl2N2O |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 1-[2-(azetidin-1-yl)ethyl]-5-[3-(2,4-dichlorophenyl)propoxy]indole |
| SMILES | Clc1ccc(CCCOc2ccc3c(ccn3CCN3CCC3)c2)c(Cl)c1 |
| InChI | InChI=1S/C22H24Cl2N2O/c23-19-5-4-17(21(24)16-19)3-1-14-27-20-6-7-22-18(15-20)8-11-26(22)13-12-25-9-2-10-25/h4-8,11,15-16H,1-3,9-10,12-14H2 |
| InChIKey | AAPUMHYGIJEFIW-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|