C17H16F3N3O — CID 141113132
2-[4-cyclopropyl-2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]-N-methylacetamide (PubChem CID 141113132) has the molecular formula C17H16F3N3O and a molecular weight of 335.33 g/mol. Its IUPAC name is 2-[4-cyclopropyl-2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]-N-methylacetamide.
| Compound Name | 2-[4-cyclopropyl-2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 141113132 |
| Molecular Formula | C17H16F3N3O |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-[4-cyclopropyl-2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]-N-methylacetamide |
| SMILES | CNC(=O)Cc1cnc(-c2ccc(C(F)(F)F)cc2)nc1C1CC1 |
| InChI | InChI=1S/C17H16F3N3O/c1-21-14(24)8-12-9-22-16(23-15(12)10-2-3-10)11-4-6-13(7-5-11)17(18,19)20/h4-7,9-10H,2-3,8H2,1H3,(H,21,24) |
| InChIKey | JJHQUEPRXFEORL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |