C32H42O10S — CID 141113220
[2,4,5-triethoxy-3-methyl-6-(2,3,5-triethoxy-4-methyl-6-prop-2-enoyloxyphenyl)sulfanylphenyl] prop-2-enoate (PubChem CID 141113220) has the molecular formula C32H42O10S and a molecular weight of 618.75 g/mol. Its IUPAC name is [2,4,5-triethoxy-3-methyl-6-(2,3,5-triethoxy-4-methyl-6-prop-2-enoyloxyphenyl)sulfanylphenyl] prop-2-enoate.
| Compound Name | [2,4,5-triethoxy-3-methyl-6-(2,3,5-triethoxy-4-methyl-6-prop-2-enoyloxyphenyl)sulfanylphenyl] prop-2-enoate |
|---|---|
| PubChem CID | 141113220 |
| Molecular Formula | C32H42O10S |
| Molecular Weight | 618.75 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | [2,4,5-triethoxy-3-methyl-6-(2,3,5-triethoxy-4-methyl-6-prop-2-enoyloxyphenyl)sulfanylphenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(OCC)c(C)c(OCC)c(OCC)c1Sc1c(OCC)c(OCC)c(C)c(OCC)c1OC(=O)C=C |
| InChI | InChI=1S/C32H42O10S/c1-11-21(33)41-29-25(37-15-5)19(9)23(35-13-3)27(39-17-7)31(29)43-32-28(40-18-8)24(36-14-4)20(10)26(38-16-6)30(32)42-22(34)12-2/h11-12H,1-2,13-18H2,3-10H3 |
| InChIKey | JHUOPZXZVJJPOL-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.75 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|