About 3-butan-2-yl-1,5-dimethyl-6-(6-propan-2-yl-3-pyridinyl)pyrrolo[2,3-b]pyridine
3-butan-2-yl-1,5-dimethyl-6-(6-propan-2-yl-3-pyridinyl)pyrrolo[2,3-b]pyridine (PubChem CID 141113400) has the molecular formula C21H27N3
and a molecular weight of 321.47 g/mol. Its IUPAC name is 3-butan-2-yl-1,5-dimethyl-6-(6-propan-2-yl-3-pyridinyl)pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-butan-2-yl-1,5-dimethyl-6-(6-propan-2-yl-3-pyridinyl)pyrrolo[2,3-b]pyridine |
| PubChem CID | 141113400 |
| Molecular Formula | C21H27N3 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 3-butan-2-yl-1,5-dimethyl-6-(6-propan-2-yl-3-pyridinyl)pyrrolo[2,3-b]pyridine |
| SMILES | CCC(C)c1cn(C)c2nc(-c3ccc(C(C)C)nc3)c(C)cc12 |
| InChI | InChI=1S/C21H27N3/c1-7-14(4)18-12-24(6)21-17(18)10-15(5)20(23-21)16-8-9-19(13(2)3)22-11-16/h8-14H,7H2,1-6H3 |
| InChIKey | ZJKZEFCFBYWICC-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-butan-2-yl-1,5-dimethyl-6-(6-propan-2-yl-3-pyridinyl)pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yl-1,5-dimethyl-6-(6-propan-2-yl-3-pyridinyl)pyrrolo[2,3-b]pyridine?
The IUPAC name of 3-butan-2-yl-1,5-dimethyl-6-(6-propan-2-yl-3-pyridinyl)pyrrolo[2,3-b]pyridine (CID 141113400) is 3-butan-2-yl-1,5-dimethyl-6-(6-propan-2-yl-3-pyridinyl)pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3-butan-2-yl-1,5-dimethyl-6-(6-propan-2-yl-3-pyridinyl)pyrrolo[2,3-b]pyridine?
The canonical SMILES for 3-butan-2-yl-1,5-dimethyl-6-(6-propan-2-yl-3-pyridinyl)pyrrolo[2,3-b]pyridine is CCC(C)c1cn(C)c2nc(-c3ccc(C(C)C)nc3)c(C)cc12.
What is the InChIKey of 3-butan-2-yl-1,5-dimethyl-6-(6-propan-2-yl-3-pyridinyl)pyrrolo[2,3-b]pyridine?
The InChIKey is ZJKZEFCFBYWICC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3/c1-7-14(4)18-12-24(6)21-17(18)10-15(5)20(23-21)16-8-9-19(13(2)3)22-11-16/h8-14H,7H2,1-6H3.
What are the key properties of 3-butan-2-yl-1,5-dimethyl-6-(6-propan-2-yl-3-pyridinyl)pyrrolo[2,3-b]pyridine?
3-butan-2-yl-1,5-dimethyl-6-(6-propan-2-yl-3-pyridinyl)pyrrolo[2,3-b]pyridine has a molecular weight of 321.47 g/mol, XLogP of 5.58, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-1,5-dimethyl-6-(6-propan-2-yl-3-pyridinyl)pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 141113400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).