About 2-methylcyclohexa-1,5-diene-1-carbonitrile
2-methylcyclohexa-1,5-diene-1-carbonitrile (PubChem CID 14111350) has the molecular formula C8H9N
and a molecular weight of 119.17 g/mol. Its IUPAC name is 2-methylcyclohexa-1,5-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 2-methylcyclohexa-1,5-diene-1-carbonitrile |
| PubChem CID | 14111350 |
| Molecular Formula | C8H9N |
| Molecular Weight | 119.17 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | 2-methylcyclohexa-1,5-diene-1-carbonitrile |
| SMILES | CC1=C(C#N)C=CCC1 |
| InChI | InChI=1S/C8H9N/c1-7-4-2-3-5-8(7)6-9/h3,5H,2,4H2,1H3 |
| InChIKey | VSQGADMJJVTKDO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.17 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylcyclohexa-1,5-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylcyclohexa-1,5-diene-1-carbonitrile?
The IUPAC name of 2-methylcyclohexa-1,5-diene-1-carbonitrile (CID 14111350) is 2-methylcyclohexa-1,5-diene-1-carbonitrile.
What is the SMILES notation for 2-methylcyclohexa-1,5-diene-1-carbonitrile?
The canonical SMILES for 2-methylcyclohexa-1,5-diene-1-carbonitrile is CC1=C(C#N)C=CCC1.
What is the InChIKey of 2-methylcyclohexa-1,5-diene-1-carbonitrile?
The InChIKey is VSQGADMJJVTKDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N/c1-7-4-2-3-5-8(7)6-9/h3,5H,2,4H2,1H3.
What are the key properties of 2-methylcyclohexa-1,5-diene-1-carbonitrile?
2-methylcyclohexa-1,5-diene-1-carbonitrile has a molecular weight of 119.17 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylcyclohexa-1,5-diene-1-carbonitrile is sourced from PubChem (CID 14111350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).