About (2S)-5-chloro-2-[(2,5-dimethylphenoxy)methyl]-1-ethyl-2,3-dihydroindole
(2S)-5-chloro-2-[(2,5-dimethylphenoxy)methyl]-1-ethyl-2,3-dihydroindole (PubChem CID 141114131) has the molecular formula C19H22ClNO
and a molecular weight of 315.84 g/mol. Its IUPAC name is (2S)-5-chloro-2-[(2,5-dimethylphenoxy)methyl]-1-ethyl-2,3-dihydroindole.
Molecular Properties
| Compound Name | (2S)-5-chloro-2-[(2,5-dimethylphenoxy)methyl]-1-ethyl-2,3-dihydroindole |
| PubChem CID | 141114131 |
| Molecular Formula | C19H22ClNO |
| Molecular Weight | 315.84 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | (2S)-5-chloro-2-[(2,5-dimethylphenoxy)methyl]-1-ethyl-2,3-dihydroindole |
| SMILES | CCN1c2ccc(Cl)cc2C[C@H]1COc1cc(C)ccc1C |
| InChI | InChI=1S/C19H22ClNO/c1-4-21-17(11-15-10-16(20)7-8-18(15)21)12-22-19-9-13(2)5-6-14(19)3/h5-10,17H,4,11-12H2,1-3H3/t17-/m0/s1 |
| InChIKey | XFACHEMIKFHZPA-KRWDZBQOSA-N |
| XLogP | 4.79 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.84 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-5-chloro-2-[(2,5-dimethylphenoxy)methyl]-1-ethyl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5-chloro-2-[(2,5-dimethylphenoxy)methyl]-1-ethyl-2,3-dihydroindole?
The IUPAC name of (2S)-5-chloro-2-[(2,5-dimethylphenoxy)methyl]-1-ethyl-2,3-dihydroindole (CID 141114131) is (2S)-5-chloro-2-[(2,5-dimethylphenoxy)methyl]-1-ethyl-2,3-dihydroindole.
What is the SMILES notation for (2S)-5-chloro-2-[(2,5-dimethylphenoxy)methyl]-1-ethyl-2,3-dihydroindole?
The canonical SMILES for (2S)-5-chloro-2-[(2,5-dimethylphenoxy)methyl]-1-ethyl-2,3-dihydroindole is CCN1c2ccc(Cl)cc2C[C@H]1COc1cc(C)ccc1C.
What is the InChIKey of (2S)-5-chloro-2-[(2,5-dimethylphenoxy)methyl]-1-ethyl-2,3-dihydroindole?
The InChIKey is XFACHEMIKFHZPA-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H22ClNO/c1-4-21-17(11-15-10-16(20)7-8-18(15)21)12-22-19-9-13(2)5-6-14(19)3/h5-10,17H,4,11-12H2,1-3H3/t17-/m0/s1.
What are the key properties of (2S)-5-chloro-2-[(2,5-dimethylphenoxy)methyl]-1-ethyl-2,3-dihydroindole?
(2S)-5-chloro-2-[(2,5-dimethylphenoxy)methyl]-1-ethyl-2,3-dihydroindole has a molecular weight of 315.84 g/mol, XLogP of 4.79, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-chloro-2-[(2,5-dimethylphenoxy)methyl]-1-ethyl-2,3-dihydroindole is sourced from PubChem (CID 141114131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).