About [3,5-dibromo-4-(2-hydroxy-4-propan-2-ylphenoxy)phenyl]methylphosphonic acid
[3,5-dibromo-4-(2-hydroxy-4-propan-2-ylphenoxy)phenyl]methylphosphonic acid (PubChem CID 141114277) has the molecular formula C16H17Br2O5P
and a molecular weight of 480.09 g/mol. Its IUPAC name is [3,5-dibromo-4-(2-hydroxy-4-propan-2-ylphenoxy)phenyl]methylphosphonic acid.
Molecular Properties
| Compound Name | [3,5-dibromo-4-(2-hydroxy-4-propan-2-ylphenoxy)phenyl]methylphosphonic acid |
| PubChem CID | 141114277 |
| Molecular Formula | C16H17Br2O5P |
| Molecular Weight | 480.09 g/mol |
| Exact Mass | 477.92 |
| IUPAC Name | [3,5-dibromo-4-(2-hydroxy-4-propan-2-ylphenoxy)phenyl]methylphosphonic acid |
| SMILES | CC(C)c1ccc(Oc2c(Br)cc(CP(=O)(O)O)cc2Br)c(O)c1 |
| InChI | InChI=1S/C16H17Br2O5P/c1-9(2)11-3-4-15(14(19)7-11)23-16-12(17)5-10(6-13(16)18)8-24(20,21)22/h3-7,9,19H,8H2,1-2H3,(H2,20,21,22) |
| InChIKey | QPAZJPSOFZRCEM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.09 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3,5-dibromo-4-(2-hydroxy-4-propan-2-ylphenoxy)phenyl]methylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-dibromo-4-(2-hydroxy-4-propan-2-ylphenoxy)phenyl]methylphosphonic acid?
The IUPAC name of [3,5-dibromo-4-(2-hydroxy-4-propan-2-ylphenoxy)phenyl]methylphosphonic acid (CID 141114277) is [3,5-dibromo-4-(2-hydroxy-4-propan-2-ylphenoxy)phenyl]methylphosphonic acid.
What is the SMILES notation for [3,5-dibromo-4-(2-hydroxy-4-propan-2-ylphenoxy)phenyl]methylphosphonic acid?
The canonical SMILES for [3,5-dibromo-4-(2-hydroxy-4-propan-2-ylphenoxy)phenyl]methylphosphonic acid is CC(C)c1ccc(Oc2c(Br)cc(CP(=O)(O)O)cc2Br)c(O)c1.
What is the InChIKey of [3,5-dibromo-4-(2-hydroxy-4-propan-2-ylphenoxy)phenyl]methylphosphonic acid?
The InChIKey is QPAZJPSOFZRCEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Br2O5P/c1-9(2)11-3-4-15(14(19)7-11)23-16-12(17)5-10(6-13(16)18)8-24(20,21)22/h3-7,9,19H,8H2,1-2H3,(H2,20,21,22).
What are the key properties of [3,5-dibromo-4-(2-hydroxy-4-propan-2-ylphenoxy)phenyl]methylphosphonic acid?
[3,5-dibromo-4-(2-hydroxy-4-propan-2-ylphenoxy)phenyl]methylphosphonic acid has a molecular weight of 480.09 g/mol, XLogP of 5.51, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dibromo-4-(2-hydroxy-4-propan-2-ylphenoxy)phenyl]methylphosphonic acid is sourced from PubChem (CID 141114277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).