About 4-[(2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol
4-[(2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol (PubChem CID 141114288) has the molecular formula C22H21FO
and a molecular weight of 320.41 g/mol. Its IUPAC name is 4-[(2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol.
Molecular Properties
| Compound Name | 4-[(2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol |
| PubChem CID | 141114288 |
| Molecular Formula | C22H21FO |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 4-[(2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol |
| SMILES | Cc1cccc(C)c1Cc1ccc(O)c(Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H21FO/c1-15-4-3-5-16(2)21(15)14-18-8-11-22(24)19(13-18)12-17-6-9-20(23)10-7-17/h3-11,13,24H,12,14H2,1-2H3 |
| InChIKey | RXOIUWSVNPXVKS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol?
The IUPAC name of 4-[(2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol (CID 141114288) is 4-[(2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol.
What is the SMILES notation for 4-[(2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol?
The canonical SMILES for 4-[(2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol is Cc1cccc(C)c1Cc1ccc(O)c(Cc2ccc(F)cc2)c1.
What is the InChIKey of 4-[(2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol?
The InChIKey is RXOIUWSVNPXVKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21FO/c1-15-4-3-5-16(2)21(15)14-18-8-11-22(24)19(13-18)12-17-6-9-20(23)10-7-17/h3-11,13,24H,12,14H2,1-2H3.
What are the key properties of 4-[(2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol?
4-[(2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol has a molecular weight of 320.41 g/mol, XLogP of 5.33, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol is sourced from PubChem (CID 141114288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).