2-(dimethylamino)ethyl 2H-pyrimidine-1-carboxylate

C9H15N3O2 — CID 141114630

IUPAC2-(dimethylamino)ethyl 2H-pyrimidine-1-carboxylate
SMILESCN(C)CCOC(=O)N1C=CC=NC1
InChIInChI=1S/C9H15N3O2/c1-11(2)6-7-14-9(13)12-5-3-4-10-8-12/h3-5H,6-8H2,1-2H3
InChIKeyVZQDEKVJFPEQIF-UHFFFAOYSA-N
MW197.24 g/mol
LogP0.54
Rot. Bonds3

About 2-(dimethylamino)ethyl 2H-pyrimidine-1-carboxylate

2-(dimethylamino)ethyl 2H-pyrimidine-1-carboxylate (PubChem CID 141114630) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2H-pyrimidine-1-carboxylate.

Molecular Properties

Compound Name2-(dimethylamino)ethyl 2H-pyrimidine-1-carboxylate
PubChem CID141114630
Molecular FormulaC9H15N3O2
Molecular Weight197.24 g/mol
Exact Mass197.12
IUPAC Name2-(dimethylamino)ethyl 2H-pyrimidine-1-carboxylate
SMILESCN(C)CCOC(=O)N1C=CC=NC1
InChIInChI=1S/C9H15N3O2/c1-11(2)6-7-14-9(13)12-5-3-4-10-8-12/h3-5H,6-8H2,1-2H3
InChIKeyVZQDEKVJFPEQIF-UHFFFAOYSA-N
XLogP0.54
TPSA45.14 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.24
LogP ≤ 50.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 2-(dimethylamino)ethyl 2H-pyrimidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(dimethylamino)ethyl 2H-pyrimidine-1-carboxylate?
The IUPAC name of 2-(dimethylamino)ethyl 2H-pyrimidine-1-carboxylate (CID 141114630) is 2-(dimethylamino)ethyl 2H-pyrimidine-1-carboxylate.
What is the SMILES notation for 2-(dimethylamino)ethyl 2H-pyrimidine-1-carboxylate?
The canonical SMILES for 2-(dimethylamino)ethyl 2H-pyrimidine-1-carboxylate is CN(C)CCOC(=O)N1C=CC=NC1.
What is the InChIKey of 2-(dimethylamino)ethyl 2H-pyrimidine-1-carboxylate?
The InChIKey is VZQDEKVJFPEQIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2/c1-11(2)6-7-14-9(13)12-5-3-4-10-8-12/h3-5H,6-8H2,1-2H3.
What are the key properties of 2-(dimethylamino)ethyl 2H-pyrimidine-1-carboxylate?
2-(dimethylamino)ethyl 2H-pyrimidine-1-carboxylate has a molecular weight of 197.24 g/mol, XLogP of 0.54, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2H-pyrimidine-1-carboxylate is sourced from PubChem (CID 141114630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).