C9H18N2O2 — CID 141114850
(2R)-1-(deuteriomethyl)-2-[(2R)-2-hydroxypropyl]pyrrolidine-2-carboxamide (PubChem CID 141114850) has the molecular formula C9H18N2O2 and a molecular weight of 187.26 g/mol. Its IUPAC name is (2R)-1-(deuteriomethyl)-2-[(2R)-2-hydroxypropyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(deuteriomethyl)-2-[(2R)-2-hydroxypropyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 141114850 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (2R)-1-(deuteriomethyl)-2-[(2R)-2-hydroxypropyl]pyrrolidine-2-carboxamide |
| SMILES | [2H]CN1CCC[C@@]1(C[C@@H](C)O)C(N)=O |
| InChI | InChI=1S/C9H18N2O2/c1-7(12)6-9(8(10)13)4-3-5-11(9)2/h7,12H,3-6H2,1-2H3,(H2,10,13)/t7-,9-/m1/s1/i2D |
| InChIKey | XDAJIDKGEQJRDN-QSDOOBBZSA-N |
| XLogP | -0.29 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |