About pyridin-4-ylmethyl 6-butyl-2-methyl-4-(4-methylphenyl)pyridine-3-carboxylate
pyridin-4-ylmethyl 6-butyl-2-methyl-4-(4-methylphenyl)pyridine-3-carboxylate (PubChem CID 141115027) has the molecular formula C24H26N2O2
and a molecular weight of 374.48 g/mol. Its IUPAC name is pyridin-4-ylmethyl 6-butyl-2-methyl-4-(4-methylphenyl)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | pyridin-4-ylmethyl 6-butyl-2-methyl-4-(4-methylphenyl)pyridine-3-carboxylate |
| PubChem CID | 141115027 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | pyridin-4-ylmethyl 6-butyl-2-methyl-4-(4-methylphenyl)pyridine-3-carboxylate |
| SMILES | CCCCc1cc(-c2ccc(C)cc2)c(C(=O)OCc2ccncc2)c(C)n1 |
| InChI | InChI=1S/C24H26N2O2/c1-4-5-6-21-15-22(20-9-7-17(2)8-10-20)23(18(3)26-21)24(27)28-16-19-11-13-25-14-12-19/h7-15H,4-6,16H2,1-3H3 |
| InChIKey | FSGUOPYMFAHNBS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridin-4-ylmethyl 6-butyl-2-methyl-4-(4-methylphenyl)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-4-ylmethyl 6-butyl-2-methyl-4-(4-methylphenyl)pyridine-3-carboxylate?
The IUPAC name of pyridin-4-ylmethyl 6-butyl-2-methyl-4-(4-methylphenyl)pyridine-3-carboxylate (CID 141115027) is pyridin-4-ylmethyl 6-butyl-2-methyl-4-(4-methylphenyl)pyridine-3-carboxylate.
What is the SMILES notation for pyridin-4-ylmethyl 6-butyl-2-methyl-4-(4-methylphenyl)pyridine-3-carboxylate?
The canonical SMILES for pyridin-4-ylmethyl 6-butyl-2-methyl-4-(4-methylphenyl)pyridine-3-carboxylate is CCCCc1cc(-c2ccc(C)cc2)c(C(=O)OCc2ccncc2)c(C)n1.
What is the InChIKey of pyridin-4-ylmethyl 6-butyl-2-methyl-4-(4-methylphenyl)pyridine-3-carboxylate?
The InChIKey is FSGUOPYMFAHNBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N2O2/c1-4-5-6-21-15-22(20-9-7-17(2)8-10-20)23(18(3)26-21)24(27)28-16-19-11-13-25-14-12-19/h7-15H,4-6,16H2,1-3H3.
What are the key properties of pyridin-4-ylmethyl 6-butyl-2-methyl-4-(4-methylphenyl)pyridine-3-carboxylate?
pyridin-4-ylmethyl 6-butyl-2-methyl-4-(4-methylphenyl)pyridine-3-carboxylate has a molecular weight of 374.48 g/mol, XLogP of 5.46, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-4-ylmethyl 6-butyl-2-methyl-4-(4-methylphenyl)pyridine-3-carboxylate is sourced from PubChem (CID 141115027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).