About 2-(3-phenylpropyl)-2,5-dihydrofuran-3-ol
2-(3-phenylpropyl)-2,5-dihydrofuran-3-ol (PubChem CID 141115159) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-(3-phenylpropyl)-2,5-dihydrofuran-3-ol.
Molecular Properties
| Compound Name | 2-(3-phenylpropyl)-2,5-dihydrofuran-3-ol |
| PubChem CID | 141115159 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2-(3-phenylpropyl)-2,5-dihydrofuran-3-ol |
| SMILES | OC1=CCOC1CCCc1ccccc1 |
| InChI | InChI=1S/C13H16O2/c14-12-9-10-15-13(12)8-4-7-11-5-2-1-3-6-11/h1-3,5-6,9,13-14H,4,7-8,10H2 |
| InChIKey | WVJCHKUXYAXSGQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-phenylpropyl)-2,5-dihydrofuran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-phenylpropyl)-2,5-dihydrofuran-3-ol?
The IUPAC name of 2-(3-phenylpropyl)-2,5-dihydrofuran-3-ol (CID 141115159) is 2-(3-phenylpropyl)-2,5-dihydrofuran-3-ol.
What is the SMILES notation for 2-(3-phenylpropyl)-2,5-dihydrofuran-3-ol?
The canonical SMILES for 2-(3-phenylpropyl)-2,5-dihydrofuran-3-ol is OC1=CCOC1CCCc1ccccc1.
What is the InChIKey of 2-(3-phenylpropyl)-2,5-dihydrofuran-3-ol?
The InChIKey is WVJCHKUXYAXSGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c14-12-9-10-15-13(12)8-4-7-11-5-2-1-3-6-11/h1-3,5-6,9,13-14H,4,7-8,10H2.
What are the key properties of 2-(3-phenylpropyl)-2,5-dihydrofuran-3-ol?
2-(3-phenylpropyl)-2,5-dihydrofuran-3-ol has a molecular weight of 204.27 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-phenylpropyl)-2,5-dihydrofuran-3-ol is sourced from PubChem (CID 141115159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).