C13H15BrF3NO — CID 141115774
4-(2-bromophenyl)-1,1,1-trifluoro-2-methanimidoyl-4-methylpentan-2-ol (PubChem CID 141115774) has the molecular formula C13H15BrF3NO and a molecular weight of 338.17 g/mol. Its IUPAC name is 4-(2-bromophenyl)-1,1,1-trifluoro-2-methanimidoyl-4-methylpentan-2-ol.
| Compound Name | 4-(2-bromophenyl)-1,1,1-trifluoro-2-methanimidoyl-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 141115774 |
| Molecular Formula | C13H15BrF3NO |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 4-(2-bromophenyl)-1,1,1-trifluoro-2-methanimidoyl-4-methylpentan-2-ol |
| SMILES | [H]/N=C/C(O)(CC(C)(C)c1ccccc1Br)C(F)(F)F |
| InChI | InChI=1S/C13H15BrF3NO/c1-11(2,9-5-3-4-6-10(9)14)7-12(19,8-18)13(15,16)17/h3-6,8,18-19H,7H2,1-2H3/b18-8+ |
| InChIKey | UZVHUTAWUGRAGM-QGMBQPNBSA-N |
| XLogP | 4.06 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|