C13H25NO — CID 141116192
2-(2,2-dimethylpropylamino)-6,6-dimethylcyclohex-3-en-1-ol (PubChem CID 141116192) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 2-(2,2-dimethylpropylamino)-6,6-dimethylcyclohex-3-en-1-ol.
| Compound Name | 2-(2,2-dimethylpropylamino)-6,6-dimethylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 141116192 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 2-(2,2-dimethylpropylamino)-6,6-dimethylcyclohex-3-en-1-ol |
| SMILES | CC(C)(C)CNC1C=CCC(C)(C)C1O |
| InChI | InChI=1S/C13H25NO/c1-12(2,3)9-14-10-7-6-8-13(4,5)11(10)15/h6-7,10-11,14-15H,8-9H2,1-5H3 |
| InChIKey | HGIHSHWLZUVGIV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|