About S-pyrrolidin-2-yl ethanethioate
S-pyrrolidin-2-yl ethanethioate (PubChem CID 141117687) has the molecular formula C6H11NOS
and a molecular weight of 145.23 g/mol. Its IUPAC name is S-pyrrolidin-2-yl ethanethioate.
Molecular Properties
| Compound Name | S-pyrrolidin-2-yl ethanethioate |
| PubChem CID | 141117687 |
| Molecular Formula | C6H11NOS |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | S-pyrrolidin-2-yl ethanethioate |
| SMILES | CC(=O)SC1CCCN1 |
| InChI | InChI=1S/C6H11NOS/c1-5(8)9-6-3-2-4-7-6/h6-7H,2-4H2,1H3 |
| InChIKey | FCSDMCONGDAIRC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-pyrrolidin-2-yl ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-pyrrolidin-2-yl ethanethioate?
The IUPAC name of S-pyrrolidin-2-yl ethanethioate (CID 141117687) is S-pyrrolidin-2-yl ethanethioate.
What is the SMILES notation for S-pyrrolidin-2-yl ethanethioate?
The canonical SMILES for S-pyrrolidin-2-yl ethanethioate is CC(=O)SC1CCCN1.
What is the InChIKey of S-pyrrolidin-2-yl ethanethioate?
The InChIKey is FCSDMCONGDAIRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NOS/c1-5(8)9-6-3-2-4-7-6/h6-7H,2-4H2,1H3.
What are the key properties of S-pyrrolidin-2-yl ethanethioate?
S-pyrrolidin-2-yl ethanethioate has a molecular weight of 145.23 g/mol, XLogP of 0.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-pyrrolidin-2-yl ethanethioate is sourced from PubChem (CID 141117687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).