About 2-oxa-5-azabicyclo[2.2.1]heptane;dihydrochloride
2-oxa-5-azabicyclo[2.2.1]heptane;dihydrochloride (PubChem CID 141117776) has the molecular formula C5H11Cl2NO
and a molecular weight of 172.05 g/mol. Its IUPAC name is 2-oxa-5-azabicyclo[2.2.1]heptane;dihydrochloride.
Molecular Properties
| Compound Name | 2-oxa-5-azabicyclo[2.2.1]heptane;dihydrochloride |
| PubChem CID | 141117776 |
| Molecular Formula | C5H11Cl2NO |
| Molecular Weight | 172.05 g/mol |
| Exact Mass | 171.02 |
| IUPAC Name | 2-oxa-5-azabicyclo[2.2.1]heptane;dihydrochloride |
| SMILES | C1OC2CNC1C2.Cl.Cl |
| InChI | InChI=1S/C5H9NO.2ClH/c1-4-3-7-5(1)2-6-4;;/h4-6H,1-3H2;2*1H |
| InChIKey | PNFJROFANLHDNW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.05 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-oxa-5-azabicyclo[2.2.1]heptane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxa-5-azabicyclo[2.2.1]heptane;dihydrochloride?
The IUPAC name of 2-oxa-5-azabicyclo[2.2.1]heptane;dihydrochloride (CID 141117776) is 2-oxa-5-azabicyclo[2.2.1]heptane;dihydrochloride.
What is the SMILES notation for 2-oxa-5-azabicyclo[2.2.1]heptane;dihydrochloride?
The canonical SMILES for 2-oxa-5-azabicyclo[2.2.1]heptane;dihydrochloride is C1OC2CNC1C2.Cl.Cl.
What is the InChIKey of 2-oxa-5-azabicyclo[2.2.1]heptane;dihydrochloride?
The InChIKey is PNFJROFANLHDNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.2ClH/c1-4-3-7-5(1)2-6-4;;/h4-6H,1-3H2;2*1H.
What are the key properties of 2-oxa-5-azabicyclo[2.2.1]heptane;dihydrochloride?
2-oxa-5-azabicyclo[2.2.1]heptane;dihydrochloride has a molecular weight of 172.05 g/mol, XLogP of 0.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxa-5-azabicyclo[2.2.1]heptane;dihydrochloride is sourced from PubChem (CID 141117776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).