About 1-diethoxyphosphoryl-2,3-dimethylbut-2-ene
1-diethoxyphosphoryl-2,3-dimethylbut-2-ene (PubChem CID 14111804) has the molecular formula C10H21O3P
and a molecular weight of 220.25 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-2,3-dimethylbut-2-ene.
Molecular Properties
| Compound Name | 1-diethoxyphosphoryl-2,3-dimethylbut-2-ene |
| PubChem CID | 14111804 |
| Molecular Formula | C10H21O3P |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1-diethoxyphosphoryl-2,3-dimethylbut-2-ene |
| SMILES | CCOP(=O)(CC(C)=C(C)C)OCC |
| InChI | InChI=1S/C10H21O3P/c1-6-12-14(11,13-7-2)8-10(5)9(3)4/h6-8H2,1-5H3 |
| InChIKey | URLIPUFIASHZSA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-diethoxyphosphoryl-2,3-dimethylbut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diethoxyphosphoryl-2,3-dimethylbut-2-ene?
The IUPAC name of 1-diethoxyphosphoryl-2,3-dimethylbut-2-ene (CID 14111804) is 1-diethoxyphosphoryl-2,3-dimethylbut-2-ene.
What is the SMILES notation for 1-diethoxyphosphoryl-2,3-dimethylbut-2-ene?
The canonical SMILES for 1-diethoxyphosphoryl-2,3-dimethylbut-2-ene is CCOP(=O)(CC(C)=C(C)C)OCC.
What is the InChIKey of 1-diethoxyphosphoryl-2,3-dimethylbut-2-ene?
The InChIKey is URLIPUFIASHZSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21O3P/c1-6-12-14(11,13-7-2)8-10(5)9(3)4/h6-8H2,1-5H3.
What are the key properties of 1-diethoxyphosphoryl-2,3-dimethylbut-2-ene?
1-diethoxyphosphoryl-2,3-dimethylbut-2-ene has a molecular weight of 220.25 g/mol, XLogP of 3.61, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diethoxyphosphoryl-2,3-dimethylbut-2-ene is sourced from PubChem (CID 14111804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).