About [4-(furan-2-yl)-1,3-thiazol-5-yl]-(5-methyl-1,3-thiazol-2-yl)methanone
[4-(furan-2-yl)-1,3-thiazol-5-yl]-(5-methyl-1,3-thiazol-2-yl)methanone (PubChem CID 141118044) has the molecular formula C12H8N2O2S2
and a molecular weight of 276.34 g/mol. Its IUPAC name is [4-(furan-2-yl)-1,3-thiazol-5-yl]-(5-methyl-1,3-thiazol-2-yl)methanone.
Molecular Properties
| Compound Name | [4-(furan-2-yl)-1,3-thiazol-5-yl]-(5-methyl-1,3-thiazol-2-yl)methanone |
| PubChem CID | 141118044 |
| Molecular Formula | C12H8N2O2S2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | [4-(furan-2-yl)-1,3-thiazol-5-yl]-(5-methyl-1,3-thiazol-2-yl)methanone |
| SMILES | Cc1cnc(C(=O)c2scnc2-c2ccco2)s1 |
| InChI | InChI=1S/C12H8N2O2S2/c1-7-5-13-12(18-7)10(15)11-9(14-6-17-11)8-3-2-4-16-8/h2-6H,1H3 |
| InChIKey | LXRSKTNIBSRUQU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(furan-2-yl)-1,3-thiazol-5-yl]-(5-methyl-1,3-thiazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(furan-2-yl)-1,3-thiazol-5-yl]-(5-methyl-1,3-thiazol-2-yl)methanone?
The IUPAC name of [4-(furan-2-yl)-1,3-thiazol-5-yl]-(5-methyl-1,3-thiazol-2-yl)methanone (CID 141118044) is [4-(furan-2-yl)-1,3-thiazol-5-yl]-(5-methyl-1,3-thiazol-2-yl)methanone.
What is the SMILES notation for [4-(furan-2-yl)-1,3-thiazol-5-yl]-(5-methyl-1,3-thiazol-2-yl)methanone?
The canonical SMILES for [4-(furan-2-yl)-1,3-thiazol-5-yl]-(5-methyl-1,3-thiazol-2-yl)methanone is Cc1cnc(C(=O)c2scnc2-c2ccco2)s1.
What is the InChIKey of [4-(furan-2-yl)-1,3-thiazol-5-yl]-(5-methyl-1,3-thiazol-2-yl)methanone?
The InChIKey is LXRSKTNIBSRUQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O2S2/c1-7-5-13-12(18-7)10(15)11-9(14-6-17-11)8-3-2-4-16-8/h2-6H,1H3.
What are the key properties of [4-(furan-2-yl)-1,3-thiazol-5-yl]-(5-methyl-1,3-thiazol-2-yl)methanone?
[4-(furan-2-yl)-1,3-thiazol-5-yl]-(5-methyl-1,3-thiazol-2-yl)methanone has a molecular weight of 276.34 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(furan-2-yl)-1,3-thiazol-5-yl]-(5-methyl-1,3-thiazol-2-yl)methanone is sourced from PubChem (CID 141118044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).