C12H15F3N2O4S — CID 141118212
2,2,2-trifluoro-N-[(2R)-1-[4-(methoxysulfamoyl)phenyl]propan-2-yl]acetamide (PubChem CID 141118212) has the molecular formula C12H15F3N2O4S and a molecular weight of 340.32 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2R)-1-[4-(methoxysulfamoyl)phenyl]propan-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2R)-1-[4-(methoxysulfamoyl)phenyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 141118212 |
| Molecular Formula | C12H15F3N2O4S |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2R)-1-[4-(methoxysulfamoyl)phenyl]propan-2-yl]acetamide |
| SMILES | CONS(=O)(=O)c1ccc(C[C@@H](C)NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3N2O4S/c1-8(16-11(18)12(13,14)15)7-9-3-5-10(6-4-9)22(19,20)17-21-2/h3-6,8,17H,7H2,1-2H3,(H,16,18)/t8-/m1/s1 |
| InChIKey | SEHRMYSAWZVMJK-MRVPVSSYSA-N |
| XLogP | 1.14 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|