About amino-tris[[tris(diethylamino)-λ5-phosphanylidene]amino]phosphanium tetrafluoroborate
amino-tris[[tris(diethylamino)-λ5-phosphanylidene]amino]phosphanium tetrafluoroborate (PubChem CID 141119117) has the molecular formula C36H92BF4N13P4
and a molecular weight of 917.92 g/mol. Its IUPAC name is amino-tris[[tris(diethylamino)-λ5-phosphanylidene]amino]phosphanium tetrafluoroborate.
Molecular Properties
| Compound Name | amino-tris[[tris(diethylamino)-λ5-phosphanylidene]amino]phosphanium tetrafluoroborate |
| PubChem CID | 141119117 |
| Molecular Formula | C36H92BF4N13P4 |
| Molecular Weight | 917.92 g/mol |
| Exact Mass | 917.66 |
| IUPAC Name | amino-tris[[tris(diethylamino)-λ5-phosphanylidene]amino]phosphanium tetrafluoroborate |
| SMILES | CCN(CC)P(=N[P+](N)(N=P(N(CC)CC)(N(CC)CC)N(CC)CC)N=P(N(CC)CC)(N(CC)CC)N(CC)CC)(N(CC)CC)N(CC)CC.F[B-](F)(F)F |
| InChI | InChI=1S/C36H92N13P4.BF4/c1-19-41(20-2)51(42(21-3)22-4,43(23-5)24-6)38-50(37,39-52(44(25-7)26-8,45(27-9)28-10)46(29-11)30-12)40-53(47(31-13)32-14,48(33-15)34-16)49(35-17)36-18;2-1(3,4)5/h19-37H2,1-18H3;/q+1;-1 |
| InChIKey | ARBOZIXGFWOYDL-UHFFFAOYSA-N |
| XLogP | 11.84 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 917.92 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze amino-tris[[tris(diethylamino)-λ5-phosphanylidene]amino]phosphanium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino-tris[[tris(diethylamino)-λ5-phosphanylidene]amino]phosphanium tetrafluoroborate?
The IUPAC name of amino-tris[[tris(diethylamino)-λ5-phosphanylidene]amino]phosphanium tetrafluoroborate (CID 141119117) is amino-tris[[tris(diethylamino)-λ5-phosphanylidene]amino]phosphanium tetrafluoroborate.
What is the SMILES notation for amino-tris[[tris(diethylamino)-λ5-phosphanylidene]amino]phosphanium tetrafluoroborate?
The canonical SMILES for amino-tris[[tris(diethylamino)-λ5-phosphanylidene]amino]phosphanium tetrafluoroborate is CCN(CC)P(=N[P+](N)(N=P(N(CC)CC)(N(CC)CC)N(CC)CC)N=P(N(CC)CC)(N(CC)CC)N(CC)CC)(N(CC)CC)N(CC)CC.F[B-](F)(F)F.
What is the InChIKey of amino-tris[[tris(diethylamino)-λ5-phosphanylidene]amino]phosphanium tetrafluoroborate?
The InChIKey is ARBOZIXGFWOYDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H92N13P4.BF4/c1-19-41(20-2)51(42(21-3)22-4,43(23-5)24-6)38-50(37,39-52(44(25-7)26-8,45(27-9)28-10)46(29-11)30-12)40-53(47(31-13)32-14,48(33-15)34-16)49(35-17)36-18;2-1(3,4)5/h19-37H2,1-18H3;/q+1;-1.
What are the key properties of amino-tris[[tris(diethylamino)-λ5-phosphanylidene]amino]phosphanium tetrafluoroborate?
amino-tris[[tris(diethylamino)-λ5-phosphanylidene]amino]phosphanium tetrafluoroborate has a molecular weight of 917.92 g/mol, XLogP of 11.84, 30 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino-tris[[tris(diethylamino)-λ5-phosphanylidene]amino]phosphanium tetrafluoroborate is sourced from PubChem (CID 141119117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).