About 1-cyclohexyl-1-(4,4-difluorocyclohexyl)-3-(5-sulfanyl-1,3-thiazol-2-yl)urea
1-cyclohexyl-1-(4,4-difluorocyclohexyl)-3-(5-sulfanyl-1,3-thiazol-2-yl)urea (PubChem CID 141119421) has the molecular formula C16H23F2N3OS2
and a molecular weight of 375.51 g/mol. Its IUPAC name is 1-cyclohexyl-1-(4,4-difluorocyclohexyl)-3-(5-sulfanyl-1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-cyclohexyl-1-(4,4-difluorocyclohexyl)-3-(5-sulfanyl-1,3-thiazol-2-yl)urea |
| PubChem CID | 141119421 |
| Molecular Formula | C16H23F2N3OS2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-cyclohexyl-1-(4,4-difluorocyclohexyl)-3-(5-sulfanyl-1,3-thiazol-2-yl)urea |
| SMILES | O=C(Nc1ncc(S)s1)N(C1CCCCC1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C16H23F2N3OS2/c17-16(18)8-6-12(7-9-16)21(11-4-2-1-3-5-11)15(22)20-14-19-10-13(23)24-14/h10-12,23H,1-9H2,(H,19,20,22) |
| InChIKey | FATFIZCPVSASLX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-1-(4,4-difluorocyclohexyl)-3-(5-sulfanyl-1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-1-(4,4-difluorocyclohexyl)-3-(5-sulfanyl-1,3-thiazol-2-yl)urea?
The IUPAC name of 1-cyclohexyl-1-(4,4-difluorocyclohexyl)-3-(5-sulfanyl-1,3-thiazol-2-yl)urea (CID 141119421) is 1-cyclohexyl-1-(4,4-difluorocyclohexyl)-3-(5-sulfanyl-1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1-cyclohexyl-1-(4,4-difluorocyclohexyl)-3-(5-sulfanyl-1,3-thiazol-2-yl)urea?
The canonical SMILES for 1-cyclohexyl-1-(4,4-difluorocyclohexyl)-3-(5-sulfanyl-1,3-thiazol-2-yl)urea is O=C(Nc1ncc(S)s1)N(C1CCCCC1)C1CCC(F)(F)CC1.
What is the InChIKey of 1-cyclohexyl-1-(4,4-difluorocyclohexyl)-3-(5-sulfanyl-1,3-thiazol-2-yl)urea?
The InChIKey is FATFIZCPVSASLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23F2N3OS2/c17-16(18)8-6-12(7-9-16)21(11-4-2-1-3-5-11)15(22)20-14-19-10-13(23)24-14/h10-12,23H,1-9H2,(H,19,20,22).
What are the key properties of 1-cyclohexyl-1-(4,4-difluorocyclohexyl)-3-(5-sulfanyl-1,3-thiazol-2-yl)urea?
1-cyclohexyl-1-(4,4-difluorocyclohexyl)-3-(5-sulfanyl-1,3-thiazol-2-yl)urea has a molecular weight of 375.51 g/mol, XLogP of 5.18, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-1-(4,4-difluorocyclohexyl)-3-(5-sulfanyl-1,3-thiazol-2-yl)urea is sourced from PubChem (CID 141119421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).