About pyrrolidine-2,5-dione;triazine
pyrrolidine-2,5-dione;triazine (PubChem CID 141119480) has the molecular formula C7H8N4O2
and a molecular weight of 180.17 g/mol. Its IUPAC name is pyrrolidine-2,5-dione;triazine.
Molecular Properties
| Compound Name | pyrrolidine-2,5-dione;triazine |
| PubChem CID | 141119480 |
| Molecular Formula | C7H8N4O2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | pyrrolidine-2,5-dione;triazine |
| SMILES | O=C1CCC(=O)N1.c1cnnnc1 |
| InChI | InChI=1S/C4H5NO2.C3H3N3/c6-3-1-2-4(7)5-3;1-2-4-6-5-3-1/h1-2H2,(H,5,6,7);1-3H |
| InChIKey | DYTSOKIHLKXINH-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze pyrrolidine-2,5-dione;triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidine-2,5-dione;triazine?
The IUPAC name of pyrrolidine-2,5-dione;triazine (CID 141119480) is pyrrolidine-2,5-dione;triazine.
What is the SMILES notation for pyrrolidine-2,5-dione;triazine?
The canonical SMILES for pyrrolidine-2,5-dione;triazine is O=C1CCC(=O)N1.c1cnnnc1.
What is the InChIKey of pyrrolidine-2,5-dione;triazine?
The InChIKey is DYTSOKIHLKXINH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.C3H3N3/c6-3-1-2-4(7)5-3;1-2-4-6-5-3-1/h1-2H2,(H,5,6,7);1-3H.
What are the key properties of pyrrolidine-2,5-dione;triazine?
pyrrolidine-2,5-dione;triazine has a molecular weight of 180.17 g/mol, XLogP of -0.71, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidine-2,5-dione;triazine is sourced from PubChem (CID 141119480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).