C15H28N2O2 — CID 141120757
4-hexyl-3-methyl-1-oxa-3,9-diazaspiro[5.5]undecan-2-one (PubChem CID 141120757) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-hexyl-3-methyl-1-oxa-3,9-diazaspiro[5.5]undecan-2-one.
| Compound Name | 4-hexyl-3-methyl-1-oxa-3,9-diazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 141120757 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 4-hexyl-3-methyl-1-oxa-3,9-diazaspiro[5.5]undecan-2-one |
| SMILES | CCCCCCC1CC2(CCNCC2)OC(=O)N1C |
| InChI | InChI=1S/C15H28N2O2/c1-3-4-5-6-7-13-12-15(8-10-16-11-9-15)19-14(18)17(13)2/h13,16H,3-12H2,1-2H3 |
| InChIKey | BLKPSEYZESEMLS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|